CAS 1465326-89-9 appears in our catalog under these names: Methyl 3,5-dichloro-4-formylbenzoate, 95%, Methyl 3,5-dichloro-4-formylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 3,5-dichloro-4-formylbenzoate (CAS 1465326-89-9) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: methyl 3,5-dichloro-4-formylbenzoate. InChIKey: PZMMESDUAFUZSK-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | methyl 3,5-dichloro-4-formylbenzoate |
| InChIKey | PZMMESDUAFUZSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)