CAS 128437-98-9 appears in our catalog under these names: 3-(3,4-Dichlorophenyl)-2-oxopropanoic acid, 95%, 3-(3,4-Dichlorophenyl)-2-oxopropanoic acid, 97%, 97%, 3-(3,4-dichlorophenyl)-2-hydroxyprop-2-enoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg, 500mg.
3-(3,4-dichlorophenyl)-2-oxopropanoic acid (CAS 128437-98-9) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-2-oxopropanoic acid. InChIKey: VXGFACIYULBZRD-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-2-oxopropanoic acid |
| InChIKey | VXGFACIYULBZRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)