Products 1565067-54-0

CAS 1565067-54-0 is the registry number for Methyl 2-(2,5-dichlorophenyl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(2,5-dichlorophenyl)-2-oxoacetate (CAS 1565067-54-0) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: methyl 2-(2,5-dichlorophenyl)-2-oxoacetate. InChIKey: OVOKZARCQCGFLX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O3
Molecular weight233.04 g/mol
IUPAC namemethyl 2-(2,5-dichlorophenyl)-2-oxoacetate
InChIKeyOVOKZARCQCGFLX-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)C1=C(C=CC(=C1)Cl)Cl

Computed by PubChem (NCBI)