CAS 1565067-54-0 is the registry number for Methyl 2-(2,5-dichlorophenyl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(2,5-dichlorophenyl)-2-oxoacetate (CAS 1565067-54-0) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: methyl 2-(2,5-dichlorophenyl)-2-oxoacetate. InChIKey: OVOKZARCQCGFLX-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | methyl 2-(2,5-dichlorophenyl)-2-oxoacetate |
| InChIKey | OVOKZARCQCGFLX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)