CAS 91569-20-9 appears in our catalog under these names: Methyl 6-amino-1-naphthoate, 97%, Methyl 6-amino-1-naphthoate, 97%, 97%, METHYL 6-AMINONAPHTHALENE-1-CARBOXYLATE HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 6-aminonaphthalene-1-carboxylate (CAS 91569-20-9) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 6-aminonaphthalene-1-carboxylate. InChIKey: GILYDTHCTQTDBA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 6-aminonaphthalene-1-carboxylate |
| InChIKey | GILYDTHCTQTDBA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)