CAS 915707-45-8 is the registry number for 3-(3-Methyl-1,2,4-oxadiazol-5-yl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid (CAS 915707-45-8) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid. InChIKey: QDXOPMMHYKGSJG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| InChIKey | QDXOPMMHYKGSJG-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)