CAS 915707-68-5 is the registry number for 3-(5-Methyl-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(5-methyl-1,3,4-oxadiazol-2-yl)benzoic acid (CAS 915707-68-5) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(5-methyl-1,3,4-oxadiazol-2-yl)benzoic acid. InChIKey: DYKMCOQUESTIOY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(5-methyl-1,3,4-oxadiazol-2-yl)benzoic acid |
| InChIKey | DYKMCOQUESTIOY-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)