CAS 916212-21-0 is the registry number for 5-Methyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid (CAS 916212-21-0) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 5-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid. InChIKey: NAFHPMYIHVFECX-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 5-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid |
| InChIKey | NAFHPMYIHVFECX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NN=CN12)C(=O)O |
Computed by PubChem (NCBI)