CAS 916483-57-3 appears in our catalog under these names: 4-Ethoxy-2,6-difluorobenzamide, 95%, 4-Ethoxy-2,6-difluorobenzamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g.
4-ethoxy-2,6-difluorobenzamide (CAS 916483-57-3) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 4-ethoxy-2,6-difluorobenzamide. InChIKey: YLNGDTJVZFEUJH-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 4-ethoxy-2,6-difluorobenzamide |
| InChIKey | YLNGDTJVZFEUJH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)C(=O)N)F |
Computed by PubChem (NCBI)