CAS 91720-32-0 appears in our catalog under these names: 6-Bromo-2,2,4-trimethyl-1,2-dihydroquinoline, 95+%, 6-Bromo-2,2,4-trimethyl-1,2-dihydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-2,2,4-trimethyl-1H-quinoline (CAS 91720-32-0) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 6-bromo-2,2,4-trimethyl-1H-quinoline. InChIKey: GQPOSFWEURXXNF-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 6-bromo-2,2,4-trimethyl-1H-quinoline |
| InChIKey | GQPOSFWEURXXNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)Br)(C)C |
Computed by PubChem (NCBI)