CAS 918418-99-2 is the registry number for ethyl 2-oxo-2-(2,4,6-trifluorophenyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-oxo-2-(2,4,6-trifluorophenyl)acetate (CAS 918418-99-2) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: ethyl 2-oxo-2-(2,4,6-trifluorophenyl)acetate. InChIKey: BGZQODNHWZDKMX-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | ethyl 2-oxo-2-(2,4,6-trifluorophenyl)acetate |
| InChIKey | BGZQODNHWZDKMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C=C1F)F)F |
Computed by PubChem (NCBI)