CAS 92-71-7 appears in our catalog under these names: 2,5-Diphenyloxazole, 98%, 2,5–Diphenyloxazole, 2,5-Diphenyloxazole, 99% , 2,5-Diphenyloxazole, 2,5-Diphenyloxazole [for scintillation spectrometry], >99.0%(HPLC)(N). Offered by: AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 25g, 100g, 500g, 0,1kg, 2.5KG, 1KG, 10g.
2,5-diphenyl-1,3-oxazole (CAS 92-71-7) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2,5-diphenyl-1,3-oxazole. InChIKey: CNRNYORZJGVOSY-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2,5-diphenyl-1,3-oxazole |
| InChIKey | CNRNYORZJGVOSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)