CAS 922169-96-8 appears in our catalog under these names: 5,6–Desmethylenedioxy–5–methoxyaglalactone, 5,6-Desmethylenedioxy-5-methoxyaglalactone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
5,7-dimethoxy-3-(4-methoxyphenyl)-3H-2-benzofuran-1-one (CAS 922169-96-8) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 5,7-dimethoxy-3-(4-methoxyphenyl)-3H-2-benzofuran-1-one. InChIKey: YNGUFTHOYVRQDO-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 5,7-dimethoxy-3-(4-methoxyphenyl)-3H-2-benzofuran-1-one |
| InChIKey | YNGUFTHOYVRQDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C3=C(C(=CC(=C3)OC)OC)C(=O)O2 |
Computed by PubChem (NCBI)