CAS 92256-33-2 is the registry number for 4-((2-(1H-Indol-3-yl)ethyl)amino)-4-oxobutanoic Acid. Offered by: TRC. Available pack sizes: 25mg.
4-[2-(1H-indol-3-yl)ethylamino]-4-oxobutanoic acid (CAS 92256-33-2) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 4-[2-(1H-indol-3-yl)ethylamino]-4-oxobutanoic acid. InChIKey: FMXUSNAWMLGDCZ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 4-[2-(1H-indol-3-yl)ethylamino]-4-oxobutanoic acid |
| InChIKey | FMXUSNAWMLGDCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)