Products 92310-70-8
CAS 92310-70-8 appears in our catalog under these names: 4-Formylphenyl dimethylcarbamate, 95%, CArbamic acid, N,N-dimethyl-, 4-formylphenyl ester, 95%, 4–formylphenyl dimethylcarbamate, 4-Formylphenyl N,N-dimethylcarbamate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(4-formylphenyl) N,N-dimethylcarbamate (CAS 92310-70-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-formylphenyl) N,N-dimethylcarbamate. InChIKey: WCOLJMAMMRLYIC-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-formylphenyl) N,N-dimethylcarbamate |
| InChIKey | WCOLJMAMMRLYIC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)