CAS 924628-44-4 appears in our catalog under these names: (E)-3-(6-Bromopyridin-3-yl)acrylic acid, 98%, (E)-3-(6-Bromopyridin-3-yl)acrylic acid, 95%, 95%, (E)-3-(6-Bromopyridin-3-yl)acrylic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(E)-3-(6-bromo-3-pyridinyl)prop-2-enoic acid (CAS 924628-44-4) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: (E)-3-(6-bromo-3-pyridinyl)prop-2-enoic acid. InChIKey: MZIMKUQFGDVIID-DUXPYHPUSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | (E)-3-(6-bromo-3-pyridinyl)prop-2-enoic acid |
| InChIKey | MZIMKUQFGDVIID-DUXPYHPUSA-N |
| SMILES | C1=CC(=NC=C1/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)