CAS 928134-57-0 is the registry number for (R)-3-Chloro-4-(6,7-dihydro-5H-pyrrolo(1,2-c)imidazol-5-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 100mg.
3-chloro-4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile (CAS 928134-57-0) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 3-chloro-4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile. InChIKey: ANDDLZUJSXKNMN-CYBMUJFWSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-chloro-4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile |
| InChIKey | ANDDLZUJSXKNMN-CYBMUJFWSA-N |
| SMILES | C1CC2=CN=CN2[C@H]1C3=C(C=C(C=C3)C#N)Cl |
Computed by PubChem (NCBI)