CAS 928208-56-4 appears in our catalog under these names: 1-Ethoxy-4-ethynyl-2,3-difluorobenzene, 1-Ethoxy-4-ethynyl-2,3-difluorobenzene, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-ethoxy-4-ethynyl-2,3-difluorobenzene (CAS 928208-56-4) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 1-ethoxy-4-ethynyl-2,3-difluorobenzene. InChIKey: IQEXLJBXLIGKOV-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-ethoxy-4-ethynyl-2,3-difluorobenzene |
| InChIKey | IQEXLJBXLIGKOV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C#C)F)F |
Computed by PubChem (NCBI)