Products 928710-74-1
CAS 928710-74-1 is the registry number for 5-(2,4-Dimethoxyphenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-(2,4-dimethoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 928710-74-1) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-(2,4-dimethoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: HIGDCZFWAGDTRR-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-(2,4-dimethoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | HIGDCZFWAGDTRR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC(=S)NN2)OC |
Computed by PubChem (NCBI)