CAS 92877-34-4 is the registry number for Diethyl acetamidomalonate-15N. Offered by: Biosynth. Available pack sizes: 1000mg.
Diethyl 2-(acetyl(15N)amino)propanedioate (CAS 92877-34-4) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 218.21 g/mol. IUPAC name: diethyl 2-(acetyl(15N)amino)propanedioate. InChIKey: ISOLMABRZPQKOV-DETAZLGJSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | diethyl 2-(acetyl(15N)amino)propanedioate |
| InChIKey | ISOLMABRZPQKOV-DETAZLGJSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)[15NH]C(=O)C |
Computed by PubChem (NCBI)