CAS 928782-97-2 appears in our catalog under these names: 4-Chloro-2-(phenylethynyl)aniline, 97%, 4-Chloro-2-(phenylethynyl)aniline. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g.
4-chloro-2-(2-phenylethynyl)aniline (CAS 928782-97-2) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 4-chloro-2-(2-phenylethynyl)aniline. InChIKey: JUMNQMVRAKHPJD-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 4-chloro-2-(2-phenylethynyl)aniline |
| InChIKey | JUMNQMVRAKHPJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)