Products 92899-33-7
CAS 92899-33-7 is the registry number for N1,N1,N3,N3-Tetraphenylbenzene-1,3-diamine, 95%. Offered by: Fluorochem. Available pack sizes: 500mg, 1g.
1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine (CAS 92899-33-7) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: 1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine. InChIKey: IOXVRZSNGAOKFG-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
| InChIKey | IOXVRZSNGAOKFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC(=CC=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)