CAS 929000-70-4 appears in our catalog under these names: 6-Methyl-8-nitro-[1,2,4]triazolo[4,3-a]pyridine, 98%, 6-Methyl-8-nitro-(1,2,4)triazolo(4,3-a)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-methyl-8-nitro-[1,2,4]triazolo[4,3-a]pyridine (CAS 929000-70-4) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 6-methyl-8-nitro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: XNJFZJNTYXYHCP-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 6-methyl-8-nitro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | XNJFZJNTYXYHCP-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=NN=C2C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)