Products 92903-56-5
CAS 92903-56-5 is the registry number for (2-Nitrophenyl)(m-tolyl)sulfane, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-chloro-N,N-bis(2-chloroethyl)aniline (CAS 92903-56-5) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 3-chloro-N,N-bis(2-chloroethyl)aniline. InChIKey: UBLVFJOJWCMQKZ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 3-chloro-N,N-bis(2-chloroethyl)aniline |
| InChIKey | UBLVFJOJWCMQKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N(CCCl)CCCl |
Computed by PubChem (NCBI)