CAS 93-27-6 appears in our catalog under these names: N-(2-Methoxy-4-nitrophenyl)acetamide, 95%, N–(2–Methoxy–4–nitrophenyl)acetamide, N-(2-Methoxy-4-nitrophenyl)acetamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
N-(2-methoxy-4-nitrophenyl)acetamide (CAS 93-27-6) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: N-(2-methoxy-4-nitrophenyl)acetamide. InChIKey: DQWRNQKJPNUTPJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | N-(2-methoxy-4-nitrophenyl)acetamide |
| InChIKey | DQWRNQKJPNUTPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)