CAS 93008-44-7 is the registry number for 1-(4-(3-(Dimethylamino)phenoxy)phenyl)ethanone, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-[4-[3-(dimethylamino)phenoxy]phenyl]ethanone (CAS 93008-44-7) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 1-[4-[3-(dimethylamino)phenoxy]phenyl]ethanone. InChIKey: RDAXFDVFDNVGDD-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 1-[4-[3-(dimethylamino)phenoxy]phenyl]ethanone |
| InChIKey | RDAXFDVFDNVGDD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=CC=CC(=C2)N(C)C |
Computed by PubChem (NCBI)