CAS 93033-57-9 is the registry number for 3,5-Dichlorobenzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[(3,5-dichlorophenyl)methylidene]hydroxylamine (CAS 93033-57-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: (NE)-N-[(3,5-dichlorophenyl)methylidene]hydroxylamine. InChIKey: AVZFLLLFEIZFGB-ONNFQVAWSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | (NE)-N-[(3,5-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | AVZFLLLFEIZFGB-ONNFQVAWSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)/C=N/O |
Computed by PubChem (NCBI)