CAS 931105-53-2 is the registry number for 2,5-Dichloro-n-methylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5-dichloro-N-methylpyridine-3-carboxamide (CAS 931105-53-2) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,5-dichloro-N-methylpyridine-3-carboxamide. InChIKey: VPMWKZHRYGXBCK-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,5-dichloro-N-methylpyridine-3-carboxamide |
| InChIKey | VPMWKZHRYGXBCK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(N=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)