Products 93156-92-4
CAS 93156-92-4 is the registry number for 3,5-Bis(1,1-dimethylethyl)-4-methoxybenzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-ditert-butyl-4-methoxybenzoic acid (CAS 93156-92-4) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 3,5-ditert-butyl-4-methoxybenzoic acid. InChIKey: XLICOLVSHXFUJG-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-methoxybenzoic acid |
| InChIKey | XLICOLVSHXFUJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-ditert-butyl-4-methoxybenzoic acid, 3,5-Bis(1,1-dimethylethyl)-4-methoxybenzoic acid, 3,5-Di-tert-butyl-4-methoxybenzoic acid, XLICOLVSHXFUJG-UHFFFAOYSA-N, 3,5-di-t-butyl-4-methoxybenzoic acid, 3,5-di-tert-butyl-4-methoxy benzoic acid, 3,5-di-tert-butyl-4-methoxy-benzoic acid, 3,5-Bis(1,1-dimethylethyl)-4-methoxy-benzoic acid