Products 93271-75-1
CAS 93271-75-1 appears in our catalog under these names: Dimethyl 2-(2-pyrimidyl)malonate, 95%, Dimethyl 2–(pyrimidin–2–yl)malonate, Dimethyl 2-(2-Pyrimidyl)malonate 98%, Dimethyl 2-(2-Pyrimidyl)malonate, 97%, 97%, DIMETHYL 2-(2-PYRIMIDYL)MALONATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg, 100mg.
Dimethyl 2-pyrimidin-2-ylpropanedioate (CAS 93271-75-1) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: dimethyl 2-pyrimidin-2-ylpropanedioate. InChIKey: UBEKYGUUQKFFTI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | dimethyl 2-pyrimidin-2-ylpropanedioate |
| InChIKey | UBEKYGUUQKFFTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=NC=CC=N1)C(=O)OC |
Computed by PubChem (NCBI)