CAS 933471-44-4 is the registry number for Methyl (3S)-3-amino-3-(4-phenylphenyl)propanoate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
Methyl (3S)-3-amino-3-(4-phenylphenyl)propanoate (CAS 933471-44-4) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (3S)-3-amino-3-(4-phenylphenyl)propanoate. InChIKey: FAOYZMMSUOXJNE-HNNXBMFYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(4-phenylphenyl)propanoate |
| InChIKey | FAOYZMMSUOXJNE-HNNXBMFYSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)