CAS 933687-22-0 appears in our catalog under these names: 2-Benzyl-1,3-thiazole-5-carboxylic acid, 95%, 2-Benzyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-benzyl-1,3-thiazole-5-carboxylic acid (CAS 933687-22-0) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-benzyl-1,3-thiazole-5-carboxylic acid. InChIKey: HJUSLPCNLXKZRT-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-benzyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | HJUSLPCNLXKZRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)