Products 935279-95-1
CAS 935279-95-1 appears in our catalog under these names: DAM–IN–1, DAM-IN-1, 97.57%, 4-(Ethoxycarbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid, 97%, 97%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 25 mg, 5 mg, 10 mg, 100mg.
4-ethoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid (CAS 935279-95-1) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 4-ethoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid. InChIKey: LQFSYWYGZHWLIW-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 4-ethoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid |
| InChIKey | LQFSYWYGZHWLIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2CC=CC2C3=C(N1)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)