CAS 935674-08-1 is the registry number for Rel-(1R,2R)-2-(4-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Trans-(1R,2R)-2-(4-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 935674-08-1) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: UUEUTHYNOREMBL-JGVFFNPUSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | UUEUTHYNOREMBL-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)