Products 936074-38-3

CAS 936074-38-3 appears in our catalog under these names: 2,4-Dimethylquinoline-7-carboxylic acid, 95%, 2,4-Dimethylquinoline-7-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2,4-dimethylquinoline-7-carboxylic acid (CAS 936074-38-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2,4-dimethylquinoline-7-carboxylic acid. InChIKey: IWKCHSWYNHEKGB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC name2,4-dimethylquinoline-7-carboxylic acid
InChIKeyIWKCHSWYNHEKGB-UHFFFAOYSA-N
SMILESCC1=CC(=NC2=C1C=CC(=C2)C(=O)O)C

Computed by PubChem (NCBI)