CAS 936551-94-9 is the registry number for 4-(1,3-Dioxolan-2-yl)-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(1,3-dioxolan-2-yl)-2-fluorobenzoic acid (CAS 936551-94-9) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: 4-(1,3-dioxolan-2-yl)-2-fluorobenzoic acid. InChIKey: FMYNJKJEXFFXCQ-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 4-(1,3-dioxolan-2-yl)-2-fluorobenzoic acid |
| InChIKey | FMYNJKJEXFFXCQ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)