CAS 936728-03-9 appears in our catalog under these names: 1-(3-Chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 98%, 1-(3-Chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 96%, 96%, 1-(3-Chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-(3-chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 936728-03-9) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 1-(3-chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: IJNNWPMZHGIFOW-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 1-(3-chloro-4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | IJNNWPMZHGIFOW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)C(=O)O)Cl |
Computed by PubChem (NCBI)