CAS 936846-32-1 appears in our catalog under these names: 1–(2–Bromo–3,4–difluorophenyl)ethanone, 1-(2-Bromo-3,4-difluorophenyl)ethanone, 97%, 97%, 2'-BROMO-3',4'-DIFLUOROACETOPHENONE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-bromo-3,4-difluorophenyl)ethanone (CAS 936846-32-1) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(2-bromo-3,4-difluorophenyl)ethanone. InChIKey: WDLYEXHPFCIQHE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(2-bromo-3,4-difluorophenyl)ethanone |
| InChIKey | WDLYEXHPFCIQHE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)