Products 937069-71-1
CAS 937069-71-1 is the registry number for 2-Chloro-3-(trifluoromethoxy)benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-3-(trifluoromethoxy)benzaldehyde (CAS 937069-71-1) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2-chloro-3-(trifluoromethoxy)benzaldehyde. InChIKey: QHUAGGPJXFTTAL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | QHUAGGPJXFTTAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)Cl)C=O |
Computed by PubChem (NCBI)