CAS 93715-53-8 appears in our catalog under these names: Methyl 2-(2-methyl-6-oxo-1,6-dihydropyrimidin-4-yl)acetate, 98+%, Methyl 2-(6-hydroxy-2-methylpyrimidin-4-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g.
Methyl 2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)acetate (CAS 93715-53-8) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: methyl 2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)acetate. InChIKey: CBYVPWZIMOUYSW-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | methyl 2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)acetate |
| InChIKey | CBYVPWZIMOUYSW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=O)N1)CC(=O)OC |
Computed by PubChem (NCBI)