Products 937601-32-6

CAS 937601-32-6 is the registry number for Ethyl 2-((4-amino-5-cyanopyrimidin-2-yl)sulfanyl)acetate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate (CAS 937601-32-6) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate. InChIKey: YSLQQNBRVLBLCM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N4O2S
Molecular weight238.27 g/mol
IUPAC nameethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate
InChIKeyYSLQQNBRVLBLCM-UHFFFAOYSA-N
SMILESCCOC(=O)CSC1=NC=C(C(=N1)N)C#N

Computed by PubChem (NCBI)