CAS 937602-51-2 is the registry number for Ethyl 5-bromo-1H-indole-2-carboxylate, N-Boc protected. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
1-O-tert-butyl 2-O-ethyl 5-bromoindole-1,2-dicarboxylate (CAS 937602-51-2) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 5-bromoindole-1,2-dicarboxylate. InChIKey: QNZSGQVIHWDDCU-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 5-bromoindole-1,2-dicarboxylate |
| InChIKey | QNZSGQVIHWDDCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br |
Computed by PubChem (NCBI)