CAS 938443-19-7 appears in our catalog under these names: 7–Chloropyrido(2,3–d)pyrimidine–2,4–diol, 7-Chloropyrido(2,3-d)pyrimidine-2,4(1H,3H)-dione, 7-Chloropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 98%, 98%, 7-Chloropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
7-chloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione (CAS 938443-19-7) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: DJHNDPHQSQMESD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | DJHNDPHQSQMESD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)NC(=O)N2)Cl |
Computed by PubChem (NCBI)