CAS 939968-87-3 is the registry number for 4-Aminopyrrolo(2,1-f)(1,2,4)triazine-7-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
4-aminopyrrolo[2,1-f][1,2,4]triazine-7-carboxylic acid (CAS 939968-87-3) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 4-aminopyrrolo[2,1-f][1,2,4]triazine-7-carboxylic acid. InChIKey: VBIFHBKBLWAJDM-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 4-aminopyrrolo[2,1-f][1,2,4]triazine-7-carboxylic acid |
| InChIKey | VBIFHBKBLWAJDM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC=NN2C(=C1)C(=O)O)N |
Computed by PubChem (NCBI)