Products 939999-70-9
CAS 939999-70-9 is the registry number for N-Amino-3,4-dichlorobenzene-1-carboximidamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N'-amino-3,4-dichlorobenzenecarboximidamide (CAS 939999-70-9) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: N'-amino-3,4-dichlorobenzenecarboximidamide. InChIKey: SBTQMGGODASKEX-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | N'-amino-3,4-dichlorobenzenecarboximidamide |
| InChIKey | SBTQMGGODASKEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1/C(=N/N)/N)Cl)Cl |
Computed by PubChem (NCBI)