CAS 940271-54-5 is the registry number for 1-((1-Methyl-1H-pyrrol-3-yl)sulfonyl)piperidine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(1-methylpyrrol-3-yl)sulfonylpiperidine-4-carboxylic acid (CAS 940271-54-5) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: 1-(1-methylpyrrol-3-yl)sulfonylpiperidine-4-carboxylic acid. InChIKey: LVUDEWHCTFCURS-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 1-(1-methylpyrrol-3-yl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | LVUDEWHCTFCURS-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=C1)S(=O)(=O)N2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)