CAS 940271-67-0 appears in our catalog under these names: (7-Bromo-2H-1,3-benzodioxol-5-yl)methanol, 95%, (7-bromo-2H-1,3-benzodioxol-5-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
(7-bromo-1,3-benzodioxol-5-yl)methanol (CAS 940271-67-0) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (7-bromo-1,3-benzodioxol-5-yl)methanol. InChIKey: MLLUEEMMMFWGFG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (7-bromo-1,3-benzodioxol-5-yl)methanol |
| InChIKey | MLLUEEMMMFWGFG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CO)Br |
Computed by PubChem (NCBI)