CAS 94166-58-2 appears in our catalog under these names: 6-Methoxy-N-methyl-3-nitropyridin-2-amine 95%, 6-Methoxy-N-methyl-3-nitropyridin-2-amine, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-methoxy-N-methyl-3-nitropyridin-2-amine (CAS 94166-58-2) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 6-methoxy-N-methyl-3-nitropyridin-2-amine. InChIKey: RSFNGZVULJTWHW-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 6-methoxy-N-methyl-3-nitropyridin-2-amine |
| InChIKey | RSFNGZVULJTWHW-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=N1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)