Products 942282-40-8
CAS 942282-40-8 appears in our catalog under these names: 4-Bromo-3-fluorophenylacetic acid, 96%, 4-Bromo-3-fluorophenylacetic acid 98%, 4-Bromo-3-fluorophenylacetic acid, 98%, 98%, 4-Bromo-3-fluorophenylacetic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 1000g, 250mg, 500g.
2-(4-bromo-3-fluorophenyl)acetic acid (CAS 942282-40-8) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)acetic acid. InChIKey: PSICSVFGBAGWMZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)acetic acid |
| InChIKey | PSICSVFGBAGWMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)Br |
Computed by PubChem (NCBI)