Products 943113-60-8

CAS 943113-60-8 is the registry number for 2-Ethyl-1-(2-methoxyethyl)-1H-benzo[d]imidazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethyl-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid (CAS 943113-60-8) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 2-ethyl-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid. InChIKey: NUYLKEGNWHZQAN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16N2O3
Molecular weight248.28 g/mol
IUPAC name2-ethyl-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid
InChIKeyNUYLKEGNWHZQAN-UHFFFAOYSA-N
SMILESCCC1=NC2=C(N1CCOC)C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)