CAS 943844-15-3 appears in our catalog under these names: tert-Butyl 5-formylpicolinate, 95%, tert–Butyl 5–formylpicolinate, 1,1-Dimethylethyl 5-formyl-2-pyridinecarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
Tert-butyl 5-formylpyridine-2-carboxylate (CAS 943844-15-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: tert-butyl 5-formylpyridine-2-carboxylate. InChIKey: NIZVLZBGMVAKTA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | tert-butyl 5-formylpyridine-2-carboxylate |
| InChIKey | NIZVLZBGMVAKTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C(C=C1)C=O |
Computed by PubChem (NCBI)